C15H20N2O3 — CID 111561014
N-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]benzamide (PubChem CID 111561014) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 111561014 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CC[C@@H](O)C1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c18-13-8-10-17(11-13)14(19)7-4-9-16-15(20)12-5-2-1-3-6-12/h1-3,5-6,13,18H,4,7-11H2,(H,16,20)/t13-/m1/s1 |
| InChIKey | GASFZLMRRLOQPY-CYBMUJFWSA-N |
| XLogP | 0.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|