C16H23N3O2 — CID 119418551
N-[4-(1,4-diazepan-1-yl)-4-oxobutyl]benzamide (PubChem CID 119418551) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-[4-(1,4-diazepan-1-yl)-4-oxobutyl]benzamide.
| Compound Name | N-[4-(1,4-diazepan-1-yl)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 119418551 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-[4-(1,4-diazepan-1-yl)-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCCNCC1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O2/c20-15(19-12-5-9-17-11-13-19)8-4-10-18-16(21)14-6-2-1-3-7-14/h1-3,6-7,17H,4-5,8-13H2,(H,18,21) |
| InChIKey | QIEDEUHJGGBWAN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|