C15H20N2O2 — CID 17154515
N-(3-oxo-3-piperidin-1-ylpropyl)benzamide (PubChem CID 17154515) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(3-oxo-3-piperidin-1-ylpropyl)benzamide.
| Compound Name | N-(3-oxo-3-piperidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 17154515 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(3-oxo-3-piperidin-1-ylpropyl)benzamide |
| SMILES | O=C(NCCC(=O)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c18-14(17-11-5-2-6-12-17)9-10-16-15(19)13-7-3-1-4-8-13/h1,3-4,7-8H,2,5-6,9-12H2,(H,16,19) |
| InChIKey | JOYSBCIHHAHXIR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |