C15H21ClN2O2 — CID 119418359
1-(1,4-diazepan-1-yl)-4-phenylbutane-1,4-dione;hydrochloride (PubChem CID 119418359) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-4-phenylbutane-1,4-dione;hydrochloride.
| Compound Name | 1-(1,4-diazepan-1-yl)-4-phenylbutane-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119418359 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-4-phenylbutane-1,4-dione;hydrochloride |
| SMILES | Cl.O=C(CCC(=O)N1CCCNCC1)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2.ClH/c18-14(13-5-2-1-3-6-13)7-8-15(19)17-11-4-9-16-10-12-17;/h1-3,5-6,16H,4,7-12H2;1H |
| InChIKey | PKHDKACLDIAIGE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |