C14H18Cl2N2O2 — CID 119402634
1-(4-chlorophenyl)-4-piperazin-1-ylbutane-1,4-dione;hydrochloride (PubChem CID 119402634) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-piperazin-1-ylbutane-1,4-dione;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)-4-piperazin-1-ylbutane-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 119402634 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-(4-chlorophenyl)-4-piperazin-1-ylbutane-1,4-dione;hydrochloride |
| SMILES | Cl.O=C(CCC(=O)N1CCNCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O2.ClH/c15-12-3-1-11(2-4-12)13(18)5-6-14(19)17-9-7-16-8-10-17;/h1-4,16H,5-10H2;1H |
| InChIKey | RENRNKBABOUAJD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |