C20H29N3O3 — CID 46103996
N-(2-benzamidoethyl)-1-pentanoylpiperidine-4-carboxamide (PubChem CID 46103996) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-1-pentanoylpiperidine-4-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-1-pentanoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46103996 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-(2-benzamidoethyl)-1-pentanoylpiperidine-4-carboxamide |
| SMILES | CCCCC(=O)N1CCC(C(=O)NCCNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H29N3O3/c1-2-3-9-18(24)23-14-10-17(11-15-23)20(26)22-13-12-21-19(25)16-7-5-4-6-8-16/h4-8,17H,2-3,9-15H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | NGMSNPYWAWRXGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|