C27H43N3O2 — CID 42881314
1-(1-octanoylpiperidin-4-yl)-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 42881314) has the molecular formula C27H43N3O2 and a molecular weight of 441.66 g/mol. Its IUPAC name is 1-(1-octanoylpiperidin-4-yl)-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-octanoylpiperidin-4-yl)-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881314 |
| Molecular Formula | C27H43N3O2 |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.34 |
| IUPAC Name | 1-(1-octanoylpiperidin-4-yl)-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | CCCCCCCC(=O)N1CCC(N2CCC(C(=O)NCCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C27H43N3O2/c1-2-3-4-5-9-12-26(31)30-21-16-25(17-22-30)29-19-14-24(15-20-29)27(32)28-18-13-23-10-7-6-8-11-23/h6-8,10-11,24-25H,2-5,9,12-22H2,1H3,(H,28,32) |
| InChIKey | MNNDSOLFKGBOGX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|