C28H37N3O3 — CID 42693509
N-(2-phenylethyl)-1-[1-(2-phenylmethoxyacetyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 42693509) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-(2-phenylethyl)-1-[1-(2-phenylmethoxyacetyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-phenylethyl)-1-[1-(2-phenylmethoxyacetyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42693509 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-(2-phenylethyl)-1-[1-(2-phenylmethoxyacetyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCN(C2CCN(C(=O)COCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C28H37N3O3/c32-27(22-34-21-24-9-5-2-6-10-24)31-19-14-26(15-20-31)30-17-12-25(13-18-30)28(33)29-16-11-23-7-3-1-4-8-23/h1-10,25-26H,11-22H2,(H,29,33) |
| InChIKey | SZQLGOIWYQMTQU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |