C25H35N3O2 — CID 25456452
1-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 25456452) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25456452 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-[1-(cyclopentene-1-carbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCN(C2CCN(C(=O)C3=CCCC3)CC2)CC1 |
| InChI | InChI=1S/C25H35N3O2/c29-24(26-15-10-20-6-2-1-3-7-20)21-11-16-27(17-12-21)23-13-18-28(19-14-23)25(30)22-8-4-5-9-22/h1-3,6-8,21,23H,4-5,9-19H2,(H,26,29) |
| InChIKey | MCKPDDCJMLGKIE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |