C26H31ClN4O4 — CID 42881321
1-[1-(2-chloro-4-nitrobenzoyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide (PubChem CID 42881321) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is 1-[1-(2-chloro-4-nitrobenzoyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[1-(2-chloro-4-nitrobenzoyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42881321 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-[1-(2-chloro-4-nitrobenzoyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CCN(C2CCN(C(=O)c3ccc([N+](=O)[O-])cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C26H31ClN4O4/c27-24-18-22(31(34)35)6-7-23(24)26(33)30-16-11-21(12-17-30)29-14-9-20(10-15-29)25(32)28-13-8-19-4-2-1-3-5-19/h1-7,18,20-21H,8-17H2,(H,28,32) |
| InChIKey | WKKZFSUTVANRRY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|