C20H21ClN2O3 — CID 25492012
(2-chloro-5-nitrophenyl)-[4-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 25492012) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-[4-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-[4-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 25492012 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-[4-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N1CCC(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClN2O3/c21-19-9-8-17(23(25)26)14-18(19)20(24)22-12-10-16(11-13-22)7-6-15-4-2-1-3-5-15/h1-5,8-9,14,16H,6-7,10-13H2 |
| InChIKey | ADBUQCUOSZYSKO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|