C14H17ClN2O3 — CID 115667738
(2-chloro-5-nitrophenyl)-(3-propylpyrrolidin-1-yl)methanone (PubChem CID 115667738) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is (2-chloro-5-nitrophenyl)-(3-propylpyrrolidin-1-yl)methanone.
| Compound Name | (2-chloro-5-nitrophenyl)-(3-propylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 115667738 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | (2-chloro-5-nitrophenyl)-(3-propylpyrrolidin-1-yl)methanone |
| SMILES | CCCC1CCN(C(=O)c2cc([N+](=O)[O-])ccc2Cl)C1 |
| InChI | InChI=1S/C14H17ClN2O3/c1-2-3-10-6-7-16(9-10)14(18)12-8-11(17(19)20)4-5-13(12)15/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | MRECREHJQAUCHF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|