C13H14ClN3O4 — CID 43082274
1-(2-chloro-5-nitrobenzoyl)piperidine-3-carboxamide (PubChem CID 43082274) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrobenzoyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-chloro-5-nitrobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43082274 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 1-(2-chloro-5-nitrobenzoyl)piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCCN(C(=O)c2cc([N+](=O)[O-])ccc2Cl)C1 |
| InChI | InChI=1S/C13H14ClN3O4/c14-11-4-3-9(17(20)21)6-10(11)13(19)16-5-1-2-8(7-16)12(15)18/h3-4,6,8H,1-2,5,7H2,(H2,15,18) |
| InChIKey | JGKJSHSDDWXDGE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|