C12H13ClN2O2S — CID 114082529
1-(2-chloro-5-sulfanylbenzoyl)pyrrolidine-3-carboxamide (PubChem CID 114082529) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 1-(2-chloro-5-sulfanylbenzoyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-chloro-5-sulfanylbenzoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114082529 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 1-(2-chloro-5-sulfanylbenzoyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2cc(S)ccc2Cl)C1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-10-2-1-8(18)5-9(10)12(17)15-4-3-7(6-15)11(14)16/h1-2,5,7,18H,3-4,6H2,(H2,14,16) |
| InChIKey | ULSINEKNDOROCS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|