C17H22ClN3O4 — CID 49407220
N-butyl-1-(2-chloro-4-nitrobenzoyl)piperidine-3-carboxamide (PubChem CID 49407220) has the molecular formula C17H22ClN3O4 and a molecular weight of 367.83 g/mol. Its IUPAC name is N-butyl-1-(2-chloro-4-nitrobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-butyl-1-(2-chloro-4-nitrobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 49407220 |
| Molecular Formula | C17H22ClN3O4 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-butyl-1-(2-chloro-4-nitrobenzoyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(C(=O)c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C17H22ClN3O4/c1-2-3-8-19-16(22)12-5-4-9-20(11-12)17(23)14-7-6-13(21(24)25)10-15(14)18/h6-7,10,12H,2-5,8-9,11H2,1H3,(H,19,22) |
| InChIKey | ACUHPJRDGUVVRF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|