C19H28N2O2 — CID 94010550
(3R)-N-butyl-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide (PubChem CID 94010550) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (3R)-N-butyl-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-butyl-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94010550 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (3R)-N-butyl-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN(C(=O)c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C19H28N2O2/c1-4-5-8-20-18(22)16-7-6-9-21(13-16)19(23)17-11-14(2)10-15(3)12-17/h10-12,16H,4-9,13H2,1-3H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | DMVDWXKMIDTKTK-MRXNPFEDSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|