C24H38N4O2 — CID 60559969
1-(3,5-dimethylbenzoyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 60559969) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60559969 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2CCCN(C(=O)c3cc(C)cc(C)c3)C2)CC1 |
| InChI | InChI=1S/C24H38N4O2/c1-4-26-11-13-27(14-12-26)9-6-8-25-23(29)21-7-5-10-28(18-21)24(30)22-16-19(2)15-20(3)17-22/h15-17,21H,4-14,18H2,1-3H3,(H,25,29) |
| InChIKey | DVRLAODOKNTVPZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|