C21H36N6O3 — CID 53010395
1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 53010395) has the molecular formula C21H36N6O3 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53010395 |
| Molecular Formula | C21H36N6O3 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)-N-[3-(4-ethylpiperazin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2CCCN(c3cc(=O)n(C)c(=O)n3C)C2)CC1 |
| InChI | InChI=1S/C21H36N6O3/c1-4-25-11-13-26(14-12-25)9-6-8-22-20(29)17-7-5-10-27(16-17)18-15-19(28)24(3)21(30)23(18)2/h15,17H,4-14,16H2,1-3H3,(H,22,29) |
| InChIKey | FNTFVZIZRMUGPN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|