C17H28N4O3 — CID 93070814
(3S)-N-butyl-1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 93070814) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is (3S)-N-butyl-1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-butyl-1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 93070814 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (3S)-N-butyl-1-(3-ethyl-1-methyl-2,6-dioxopyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CCCN(c2cc(=O)n(C)c(=O)n2CC)C1 |
| InChI | InChI=1S/C17H28N4O3/c1-4-6-9-18-16(23)13-8-7-10-20(12-13)14-11-15(22)19(3)17(24)21(14)5-2/h11,13H,4-10,12H2,1-3H3,(H,18,23)/t13-/m0/s1 |
| InChIKey | URZJDZIHIFUAMY-ZDUSSCGKSA-N |
| XLogP | 0.70 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|