C22H33N3O2 — CID 119555717
1-(3,5-dimethylbenzoyl)-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide (PubChem CID 119555717) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119555717 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-(2-piperidin-3-ylethyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCC(C(=O)NCCC3CCCNC3)C2)c1 |
| InChI | InChI=1S/C22H33N3O2/c1-16-11-17(2)13-20(12-16)22(27)25-10-4-6-19(15-25)21(26)24-9-7-18-5-3-8-23-14-18/h11-13,18-19,23H,3-10,14-15H2,1-2H3,(H,24,26) |
| InChIKey | OAIMLJDJZCOZCA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |