C22H34N4O2 — CID 119391295
1-(3,5-dimethylbenzoyl)-N-(3-piperazin-1-ylpropyl)piperidine-3-carboxamide (PubChem CID 119391295) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-(3-piperazin-1-ylpropyl)piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-(3-piperazin-1-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119391295 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-(3-piperazin-1-ylpropyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCC(C(=O)NCCCN3CCNCC3)C2)c1 |
| InChI | InChI=1S/C22H34N4O2/c1-17-13-18(2)15-20(14-17)22(28)26-10-3-5-19(16-26)21(27)24-6-4-9-25-11-7-23-8-12-25/h13-15,19,23H,3-12,16H2,1-2H3,(H,24,27) |
| InChIKey | DTZONRZOBXCYOG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|