C24H31N3O2 — CID 55789576
1-(3,5-dimethylbenzoyl)-N-[2-(N-methylanilino)ethyl]piperidine-3-carboxamide (PubChem CID 55789576) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzoyl)-N-[2-(N-methylanilino)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-(3,5-dimethylbenzoyl)-N-[2-(N-methylanilino)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55789576 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-(3,5-dimethylbenzoyl)-N-[2-(N-methylanilino)ethyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCC(C(=O)NCCN(C)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H31N3O2/c1-18-14-19(2)16-21(15-18)24(29)27-12-7-8-20(17-27)23(28)25-11-13-26(3)22-9-5-4-6-10-22/h4-6,9-10,14-16,20H,7-8,11-13,17H2,1-3H3,(H,25,28) |
| InChIKey | OEGDCBITLFYXPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |