C12H16N2O4 — CID 62917113
N-[3-(3-hydroxypyrrolidin-1-yl)-3-oxopropyl]furan-3-carboxamide (PubChem CID 62917113) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[3-(3-hydroxypyrrolidin-1-yl)-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-[3-(3-hydroxypyrrolidin-1-yl)-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 62917113 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[3-(3-hydroxypyrrolidin-1-yl)-3-oxopropyl]furan-3-carboxamide |
| SMILES | O=C(NCCC(=O)N1CCC(O)C1)c1ccoc1 |
| InChI | InChI=1S/C12H16N2O4/c15-10-2-5-14(7-10)11(16)1-4-13-12(17)9-3-6-18-8-9/h3,6,8,10,15H,1-2,4-5,7H2,(H,13,17) |
| InChIKey | CPPBRNMQTXEPTL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |