C13H17N3O4 — CID 62046066
N-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)propyl]furan-3-carboxamide (PubChem CID 62046066) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)propyl]furan-3-carboxamide.
| Compound Name | N-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 62046066 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[3-oxo-3-(5-oxo-1,4-diazepan-1-yl)propyl]furan-3-carboxamide |
| SMILES | O=C1CCN(C(=O)CCNC(=O)c2ccoc2)CCN1 |
| InChI | InChI=1S/C13H17N3O4/c17-11-2-6-16(7-5-14-11)12(18)1-4-15-13(19)10-3-8-20-9-10/h3,8-9H,1-2,4-7H2,(H,14,17)(H,15,19) |
| InChIKey | RIPHTCGAFQFVRS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |