C24H23N3O3S — CID 27782574
1-[[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione (PubChem CID 27782574) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is 1-[[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 27782574 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-[[4-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(CN2C(=O)CCC2=O)cc1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C24H23N3O3S/c28-21-9-10-22(29)27(21)15-16-5-7-18(8-6-16)24(30)26-13-11-17(12-14-26)23-25-19-3-1-2-4-20(19)31-23/h1-8,17H,9-15H2 |
| InChIKey | OLJTWFLGGQXYHI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|