C17H16N2OS2 — CID 27782572
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone (PubChem CID 27782572) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 27782572 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H16N2OS2/c20-17(13-7-10-21-11-13)19-8-5-12(6-9-19)16-18-14-3-1-2-4-15(14)22-16/h1-4,7,10-12H,5-6,8-9H2 |
| InChIKey | BNGUSXQKZKZYIO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |