C19H17IN2OS — CID 21007826
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-iodophenyl)methanone (PubChem CID 21007826) has the molecular formula C19H17IN2OS and a molecular weight of 448.33 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-iodophenyl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-iodophenyl)methanone |
|---|---|
| PubChem CID | 21007826 |
| Molecular Formula | C19H17IN2OS |
| Molecular Weight | 448.33 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-iodophenyl)methanone |
| SMILES | O=C(c1ccccc1I)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C19H17IN2OS/c20-15-6-2-1-5-14(15)19(23)22-11-9-13(10-12-22)18-21-16-7-3-4-8-17(16)24-18/h1-8,13H,9-12H2 |
| InChIKey | UIYGMZVYLTUGRN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|