C18H17N3OS2 — CID 43046487
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-sulfanylidene-1H-pyridin-3-yl)methanone (PubChem CID 43046487) has the molecular formula C18H17N3OS2 and a molecular weight of 355.49 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-sulfanylidene-1H-pyridin-3-yl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-sulfanylidene-1H-pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 43046487 |
| Molecular Formula | C18H17N3OS2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(2-sulfanylidene-1H-pyridin-3-yl)methanone |
| SMILES | O=C(c1ccc[nH]c1=S)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H17N3OS2/c22-18(13-4-3-9-19-16(13)23)21-10-7-12(8-11-21)17-20-14-5-1-2-6-15(14)24-17/h1-6,9,12H,7-8,10-11H2,(H,19,23) |
| InChIKey | LMVOJBCODXIHPS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|