C22H20N4OS2 — CID 24544575
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 24544575) has the molecular formula C22H20N4OS2 and a molecular weight of 420.56 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 24544575 |
| Molecular Formula | C22H20N4OS2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCC(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C22H20N4OS2/c27-21(18-14-23-22(28)26(18)16-6-2-1-3-7-16)25-12-10-15(11-13-25)20-24-17-8-4-5-9-19(17)29-20/h1-9,14-15H,10-13H2,(H,23,28) |
| InChIKey | GKEYXRFBNBSRRH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|