C21H20FN3OS — CID 39581666
[3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]-(4-phenylpiperidin-1-yl)methanone (PubChem CID 39581666) has the molecular formula C21H20FN3OS and a molecular weight of 381.48 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]-(4-phenylpiperidin-1-yl)methanone.
| Compound Name | [3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]-(4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 39581666 |
| Molecular Formula | C21H20FN3OS |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [3-(4-fluorophenyl)-2-sulfanylidene-1H-imidazol-4-yl]-(4-phenylpiperidin-1-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccc(F)cc1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H20FN3OS/c22-17-6-8-18(9-7-17)25-19(14-23-21(25)27)20(26)24-12-10-16(11-13-24)15-4-2-1-3-5-15/h1-9,14,16H,10-13H2,(H,23,27) |
| InChIKey | SSNLYZTUDBXJAN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|