C20H19N5O5S2 — CID 34234262
[4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 34234262) has the molecular formula C20H19N5O5S2 and a molecular weight of 473.54 g/mol. Its IUPAC name is [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 34234262 |
| Molecular Formula | C20H19N5O5S2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [4-(2-nitrophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H19N5O5S2/c26-19(17-14-21-20(31)24(17)15-6-2-1-3-7-15)22-10-12-23(13-11-22)32(29,30)18-9-5-4-8-16(18)25(27)28/h1-9,14H,10-13H2,(H,21,31) |
| InChIKey | HHLYDOOSLDJRQL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 121.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|