C20H19FN4O3S2 — CID 25343053
[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone (PubChem CID 25343053) has the molecular formula C20H19FN4O3S2 and a molecular weight of 446.53 g/mol. Its IUPAC name is [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone.
| Compound Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
|---|---|
| PubChem CID | 25343053 |
| Molecular Formula | C20H19FN4O3S2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(3-phenyl-2-sulfanylidene-1H-imidazol-4-yl)methanone |
| SMILES | O=C(c1c[nH]c(=S)n1-c1ccccc1)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H19FN4O3S2/c21-15-5-4-8-17(13-15)30(27,28)24-11-9-23(10-12-24)19(26)18-14-22-20(29)25(18)16-6-2-1-3-7-16/h1-8,13-14H,9-12H2,(H,22,29) |
| InChIKey | QZIVKDFJTCKOIT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|