C15H14BrFN2O3S2 — CID 27828067
(5-bromothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27828067) has the molecular formula C15H14BrFN2O3S2 and a molecular weight of 433.32 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-bromothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27828067 |
| Molecular Formula | C15H14BrFN2O3S2 |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | (5-bromothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)s1)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H14BrFN2O3S2/c16-14-5-4-13(23-14)15(20)18-6-8-19(9-7-18)24(21,22)12-3-1-2-11(17)10-12/h1-5,10H,6-9H2 |
| InChIKey | VACUAPWDDJKOIY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |