C17H15BrF2N2O3S — CID 26559299
[4-(3-bromophenyl)sulfonylpiperazin-1-yl]-(2,4-difluorophenyl)methanone (PubChem CID 26559299) has the molecular formula C17H15BrF2N2O3S and a molecular weight of 445.29 g/mol. Its IUPAC name is [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-(2,4-difluorophenyl)methanone.
| Compound Name | [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 26559299 |
| Molecular Formula | C17H15BrF2N2O3S |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [4-(3-bromophenyl)sulfonylpiperazin-1-yl]-(2,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1F)N1CCN(S(=O)(=O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C17H15BrF2N2O3S/c18-12-2-1-3-14(10-12)26(24,25)22-8-6-21(7-9-22)17(23)15-5-4-13(19)11-16(15)20/h1-5,10-11H,6-9H2 |
| InChIKey | RSNPAHOYBSGMRO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |