C19H16ClFN2O3S2 — CID 27828128
(3-chloro-1-benzothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 27828128) has the molecular formula C19H16ClFN2O3S2 and a molecular weight of 438.93 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 27828128 |
| Molecular Formula | C19H16ClFN2O3S2 |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1sc2ccccc2c1Cl)N1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H16ClFN2O3S2/c20-17-15-6-1-2-7-16(15)27-18(17)19(24)22-8-10-23(11-9-22)28(25,26)14-5-3-4-13(21)12-14/h1-7,12H,8-11H2 |
| InChIKey | HOYFDPYDEPKLIT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |