C20H18ClN3O5S2 — CID 2578784
3-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-1-benzothiophene-2-carbohydrazide (PubChem CID 2578784) has the molecular formula C20H18ClN3O5S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 3-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-1-benzothiophene-2-carbohydrazide.
| Compound Name | 3-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2578784 |
| Molecular Formula | C20H18ClN3O5S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 3-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-1-benzothiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sc2ccccc2c1Cl)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H18ClN3O5S2/c21-17-15-6-1-2-7-16(15)30-18(17)20(26)23-22-19(25)13-4-3-5-14(12-13)31(27,28)24-8-10-29-11-9-24/h1-7,12H,8-11H2,(H,22,25)(H,23,26) |
| InChIKey | MTHYSQKQGMLVJE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|