C20H21ClN4O6S — CID 2078880
2-chloro-N-[2-[2-(3-morpholin-4-ylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 2078880) has the molecular formula C20H21ClN4O6S and a molecular weight of 480.93 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(3-morpholin-4-ylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[2-(3-morpholin-4-ylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2078880 |
| Molecular Formula | C20H21ClN4O6S |
| Molecular Weight | 480.93 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 2-chloro-N-[2-[2-(3-morpholin-4-ylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)NNC(=O)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H21ClN4O6S/c21-17-7-2-1-6-16(17)20(28)22-13-18(26)23-24-19(27)14-4-3-5-15(12-14)32(29,30)25-8-10-31-11-9-25/h1-7,12H,8-11,13H2,(H,22,28)(H,23,26)(H,24,27) |
| InChIKey | HFXATAMVZOAXQV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.93 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|