C18H19FN2O5S2 — CID 26558503
[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylsulfonylphenyl)methanone (PubChem CID 26558503) has the molecular formula C18H19FN2O5S2 and a molecular weight of 426.49 g/mol. Its IUPAC name is [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylsulfonylphenyl)methanone.
| Compound Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 26558503 |
| Molecular Formula | C18H19FN2O5S2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-(4-methylsulfonylphenyl)methanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C18H19FN2O5S2/c1-27(23,24)16-7-5-14(6-8-16)18(22)20-9-11-21(12-10-20)28(25,26)17-4-2-3-15(19)13-17/h2-8,13H,9-12H2,1H3 |
| InChIKey | CXCCSDSGEZWRFL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |