C18H19FN4O5S — CID 27828010
[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-[4-(methylamino)-3-nitrophenyl]methanone (PubChem CID 27828010) has the molecular formula C18H19FN4O5S and a molecular weight of 422.44 g/mol. Its IUPAC name is [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-[4-(methylamino)-3-nitrophenyl]methanone.
| Compound Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-[4-(methylamino)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 27828010 |
| Molecular Formula | C18H19FN4O5S |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-[4-(methylamino)-3-nitrophenyl]methanone |
| SMILES | CNc1ccc(C(=O)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19FN4O5S/c1-20-16-6-5-13(11-17(16)23(25)26)18(24)21-7-9-22(10-8-21)29(27,28)15-4-2-3-14(19)12-15/h2-6,11-12,20H,7-10H2,1H3 |
| InChIKey | TYKMTVPKYJSXCQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|