C19H19FN4O8S — CID 55667724
methyl 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667724) has the molecular formula C19H19FN4O8S and a molecular weight of 482.45 g/mol. Its IUPAC name is methyl 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667724 |
| Molecular Formula | C19H19FN4O8S |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | methyl 1-[2-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H19FN4O8S/c1-32-19(27)13-9-16(24(28)29)18(26)22(11-13)12-17(25)21-5-7-23(8-6-21)33(30,31)15-4-2-3-14(20)10-15/h2-4,9-11H,5-8,12H2,1H3 |
| InChIKey | RHVUGTMPZOZSME-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 149.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|