C20H19N5O8S — CID 55665219
methyl 1-[2-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55665219) has the molecular formula C20H19N5O8S and a molecular weight of 489.47 g/mol. Its IUPAC name is methyl 1-[2-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55665219 |
| Molecular Formula | C20H19N5O8S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | methyl 1-[2-[4-(2-cyanophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)N2CCN(S(=O)(=O)c3ccccc3C#N)CC2)c1 |
| InChI | InChI=1S/C20H19N5O8S/c1-33-20(28)15-10-16(25(29)30)19(27)23(12-15)13-18(26)22-6-8-24(9-7-22)34(31,32)17-5-3-2-4-14(17)11-21/h2-5,10,12H,6-9,13H2,1H3 |
| InChIKey | FHHWWPBKEJQNRI-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 172.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|