C17H15N3O6 — CID 55667375
methyl 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667375) has the molecular formula C17H15N3O6 and a molecular weight of 357.32 g/mol. Its IUPAC name is methyl 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667375 |
| Molecular Formula | C17H15N3O6 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | methyl 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(=O)n(CC(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H15N3O6/c1-26-17(23)12-8-14(20(24)25)16(22)18(9-12)10-15(21)19-7-6-11-4-2-3-5-13(11)19/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | AQFBXNWRTJZSMK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 111.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|