C18H16N2O5S — CID 7678688
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7678688) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7678688 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCC(=O)N2CCc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O5S/c1-26-16-7-6-13(10-15(16)20(23)24)18(22)25-11-17(21)19-9-8-12-4-2-3-5-14(12)19/h2-7,10H,8-9,11H2,1H3 |
| InChIKey | VECHYKZKHIMDNA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|