C13H13N3O6S — CID 7361745
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7361745) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7361745 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCC(=O)N2CCNC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N3O6S/c1-23-10-3-2-8(6-9(10)16(20)21)12(18)22-7-11(17)15-5-4-14-13(15)19/h2-3,6H,4-5,7H2,1H3,(H,14,19) |
| InChIKey | FKQBLOBJBSZTPG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|