C13H14N4O6 — CID 46619837
[1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-amino-3-nitrobenzoate (PubChem CID 46619837) has the molecular formula C13H14N4O6 and a molecular weight of 322.28 g/mol. Its IUPAC name is [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-amino-3-nitrobenzoate.
| Compound Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 46619837 |
| Molecular Formula | C13H14N4O6 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-amino-3-nitrobenzoate |
| SMILES | CC(OC(=O)c1ccc(N)c([N+](=O)[O-])c1)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C13H14N4O6/c1-7(11(18)16-5-4-15-13(16)20)23-12(19)8-2-3-9(14)10(6-8)17(21)22/h2-3,6-7H,4-5,14H2,1H3,(H,15,20) |
| InChIKey | VQYVVXBNZVCMNN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|