C14H13F3N2O4S — CID 17396800
[1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(trifluoromethylsulfanyl)benzoate (PubChem CID 17396800) has the molecular formula C14H13F3N2O4S and a molecular weight of 362.33 g/mol. Its IUPAC name is [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(trifluoromethylsulfanyl)benzoate.
| Compound Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(trifluoromethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 17396800 |
| Molecular Formula | C14H13F3N2O4S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(trifluoromethylsulfanyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(SC(F)(F)F)cc1)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C14H13F3N2O4S/c1-8(11(20)19-7-6-18-13(19)22)23-12(21)9-2-4-10(5-3-9)24-14(15,16)17/h2-5,8H,6-7H2,1H3,(H,18,22) |
| InChIKey | UDPQBFSFABFRHV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |