C15H19N3O4 — CID 18090949
[1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(dimethylamino)benzoate (PubChem CID 18090949) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(dimethylamino)benzoate.
| Compound Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 18090949 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | [1-oxo-1-(2-oxoimidazolidin-1-yl)propan-2-yl] 4-(dimethylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(N(C)C)cc1)C(=O)N1CCNC1=O |
| InChI | InChI=1S/C15H19N3O4/c1-10(13(19)18-9-8-16-15(18)21)22-14(20)11-4-6-12(7-5-11)17(2)3/h4-7,10H,8-9H2,1-3H3,(H,16,21) |
| InChIKey | GHSOJZGNBGTRJO-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |