C14H17N3O4 — CID 8533602
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-(dimethylamino)benzoate (PubChem CID 8533602) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 8533602 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(=O)N2CCNC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-16(2)11-5-3-10(4-6-11)13(19)21-9-12(18)17-8-7-15-14(17)20/h3-6H,7-9H2,1-2H3,(H,15,20) |
| InChIKey | IGLOZYVLFSAUPM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |