C25H29N3O5 — CID 23907963
[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 23907963) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 23907963 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | [2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 4-(3,5-dimethylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CC(C)CN(c2ccc(C(=O)OCC(=O)N3CCCc4ccccc43)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C25H29N3O5/c1-17-12-18(2)15-26(14-17)22-10-9-20(13-23(22)28(31)32)25(30)33-16-24(29)27-11-5-7-19-6-3-4-8-21(19)27/h3-4,6,8-10,13,17-18H,5,7,11-12,14-16H2,1-2H3 |
| InChIKey | KRDQXJLFHBOFNV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|