C23H24N4O5 — CID 41093870
[2-(2-cyanoanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 41093870) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 41093870 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@H]1C[C@H](C)CN(c2ccc(C(=O)OCC(=O)Nc3ccccc3C#N)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C23H24N4O5/c1-15-9-16(2)13-26(12-15)20-8-7-17(10-21(20)27(30)31)23(29)32-14-22(28)25-19-6-4-3-5-18(19)11-24/h3-8,10,15-16H,9,12-14H2,1-2H3,(H,25,28)/t15-,16-/m0/s1 |
| InChIKey | FNIWRMKYTDOWGE-HOTGVXAUSA-N |
| XLogP | 3.74 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|